C16H9BrF2N2 — CID 106266361
1-[(3-bromo-2,6-difluorophenyl)methyl]indole-5-carbonitrile (PubChem CID 106266361) has the molecular formula C16H9BrF2N2 and a molecular weight of 347.16 g/mol. Its IUPAC name is 1-[(3-bromo-2,6-difluorophenyl)methyl]indole-5-carbonitrile.
| Compound Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]indole-5-carbonitrile |
|---|---|
| PubChem CID | 106266361 |
| Molecular Formula | C16H9BrF2N2 |
| Molecular Weight | 347.16 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]indole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(ccn2Cc2c(F)ccc(Br)c2F)c1 |
| InChI | InChI=1S/C16H9BrF2N2/c17-13-2-3-14(18)12(16(13)19)9-21-6-5-11-7-10(8-20)1-4-15(11)21/h1-7H,9H2 |
| InChIKey | AYYGCDDOKFGWPK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.16 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|