C15H9BrF3N — CID 106270507
1-[(3-bromo-2,6-difluorophenyl)methyl]-6-fluoroindole (PubChem CID 106270507) has the molecular formula C15H9BrF3N and a molecular weight of 340.14 g/mol. Its IUPAC name is 1-[(3-bromo-2,6-difluorophenyl)methyl]-6-fluoroindole.
| Compound Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-6-fluoroindole |
|---|---|
| PubChem CID | 106270507 |
| Molecular Formula | C15H9BrF3N |
| Molecular Weight | 340.14 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-6-fluoroindole |
| SMILES | Fc1ccc2ccn(Cc3c(F)ccc(Br)c3F)c2c1 |
| InChI | InChI=1S/C15H9BrF3N/c16-12-3-4-13(18)11(15(12)19)8-20-6-5-9-1-2-10(17)7-14(9)20/h1-7H,8H2 |
| InChIKey | BPPNZIHIVRIKGB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.14 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|