C15H10F3N — CID 22256789
1-[(2,3,6-trifluorophenyl)methyl]indole (PubChem CID 22256789) has the molecular formula C15H10F3N and a molecular weight of 261.25 g/mol. Its IUPAC name is 1-[(2,3,6-trifluorophenyl)methyl]indole.
| Compound Name | 1-[(2,3,6-trifluorophenyl)methyl]indole |
|---|---|
| PubChem CID | 22256789 |
| Molecular Formula | C15H10F3N |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 1-[(2,3,6-trifluorophenyl)methyl]indole |
| SMILES | Fc1ccc(F)c(Cn2ccc3ccccc32)c1F |
| InChI | InChI=1S/C15H10F3N/c16-12-5-6-13(17)15(18)11(12)9-19-8-7-10-3-1-2-4-14(10)19/h1-8H,9H2 |
| InChIKey | VRMZPGYKTMMXHJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|