About cobalt;1-ethyl-6-fluoroindole
cobalt;1-ethyl-6-fluoroindole (PubChem CID 58657570) has the molecular formula C10H9CoFN-
and a molecular weight of 221.12 g/mol. Its IUPAC name is cobalt;1-ethyl-6-fluoroindole.
Molecular Properties
| Compound Name | cobalt;1-ethyl-6-fluoroindole |
| PubChem CID | 58657570 |
| Molecular Formula | C10H9CoFN- |
| Molecular Weight | 221.12 g/mol |
| Exact Mass | 221.01 |
| IUPAC Name | cobalt;1-ethyl-6-fluoroindole |
| SMILES | [CH2-]Cn1ccc2ccc(F)cc21.[Co] |
| InChI | InChI=1S/C10H9FN.Co/c1-2-12-6-5-8-3-4-9(11)7-10(8)12;/h3-7H,1-2H2;/q-1; |
| InChIKey | QREIHNGYIALRMU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.12 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cobalt;1-ethyl-6-fluoroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;1-ethyl-6-fluoroindole?
The IUPAC name of cobalt;1-ethyl-6-fluoroindole (CID 58657570) is cobalt;1-ethyl-6-fluoroindole.
What is the SMILES notation for cobalt;1-ethyl-6-fluoroindole?
The canonical SMILES for cobalt;1-ethyl-6-fluoroindole is [CH2-]Cn1ccc2ccc(F)cc21.[Co].
What is the InChIKey of cobalt;1-ethyl-6-fluoroindole?
The InChIKey is QREIHNGYIALRMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN.Co/c1-2-12-6-5-8-3-4-9(11)7-10(8)12;/h3-7H,1-2H2;/q-1;.
What are the key properties of cobalt;1-ethyl-6-fluoroindole?
cobalt;1-ethyl-6-fluoroindole has a molecular weight of 221.12 g/mol, XLogP of 2.61, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;1-ethyl-6-fluoroindole is sourced from PubChem (CID 58657570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).