About 6-fluoro-1-nonylindole
6-fluoro-1-nonylindole (PubChem CID 116619867) has the molecular formula C17H24FN
and a molecular weight of 261.38 g/mol. Its IUPAC name is 6-fluoro-1-nonylindole.
Molecular Properties
| Compound Name | 6-fluoro-1-nonylindole |
| PubChem CID | 116619867 |
| Molecular Formula | C17H24FN |
| Molecular Weight | 261.38 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | 6-fluoro-1-nonylindole |
| SMILES | CCCCCCCCCn1ccc2ccc(F)cc21 |
| InChI | InChI=1S/C17H24FN/c1-2-3-4-5-6-7-8-12-19-13-11-15-9-10-16(18)14-17(15)19/h9-11,13-14H,2-8,12H2,1H3 |
| InChIKey | LZIZUTJEWSZSAP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.38 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-1-nonylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1-nonylindole?
The IUPAC name of 6-fluoro-1-nonylindole (CID 116619867) is 6-fluoro-1-nonylindole.
What is the SMILES notation for 6-fluoro-1-nonylindole?
The canonical SMILES for 6-fluoro-1-nonylindole is CCCCCCCCCn1ccc2ccc(F)cc21.
What is the InChIKey of 6-fluoro-1-nonylindole?
The InChIKey is LZIZUTJEWSZSAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24FN/c1-2-3-4-5-6-7-8-12-19-13-11-15-9-10-16(18)14-17(15)19/h9-11,13-14H,2-8,12H2,1H3.
What are the key properties of 6-fluoro-1-nonylindole?
6-fluoro-1-nonylindole has a molecular weight of 261.38 g/mol, XLogP of 5.53, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1-nonylindole is sourced from PubChem (CID 116619867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).