About 1-butyl-6-chloroindole
1-butyl-6-chloroindole (PubChem CID 67583801) has the molecular formula C12H14ClN
and a molecular weight of 207.70 g/mol. Its IUPAC name is 1-butyl-6-chloroindole.
Molecular Properties
| Compound Name | 1-butyl-6-chloroindole |
| PubChem CID | 67583801 |
| Molecular Formula | C12H14ClN |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 1-butyl-6-chloroindole |
| SMILES | CCCCn1ccc2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H14ClN/c1-2-3-7-14-8-6-10-4-5-11(13)9-12(10)14/h4-6,8-9H,2-3,7H2,1H3 |
| InChIKey | VFQDZRZQZLTEPF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-butyl-6-chloroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-6-chloroindole?
The IUPAC name of 1-butyl-6-chloroindole (CID 67583801) is 1-butyl-6-chloroindole.
What is the SMILES notation for 1-butyl-6-chloroindole?
The canonical SMILES for 1-butyl-6-chloroindole is CCCCn1ccc2ccc(Cl)cc21.
What is the InChIKey of 1-butyl-6-chloroindole?
The InChIKey is VFQDZRZQZLTEPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN/c1-2-3-7-14-8-6-10-4-5-11(13)9-12(10)14/h4-6,8-9H,2-3,7H2,1H3.
What are the key properties of 1-butyl-6-chloroindole?
1-butyl-6-chloroindole has a molecular weight of 207.70 g/mol, XLogP of 4.09, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-6-chloroindole is sourced from PubChem (CID 67583801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).