C11H11NO2S — CID 104804258
4-pent-3-ynylsulfanylpyridine-2-carboxylic acid (PubChem CID 104804258) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is 4-pent-3-ynylsulfanylpyridine-2-carboxylic acid.
| Compound Name | 4-pent-3-ynylsulfanylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 104804258 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 4-pent-3-ynylsulfanylpyridine-2-carboxylic acid |
| SMILES | CC#CCCSc1ccnc(C(=O)O)c1 |
| InChI | InChI=1S/C11H11NO2S/c1-2-3-4-7-15-9-5-6-12-10(8-9)11(13)14/h5-6,8H,4,7H2,1H3,(H,13,14) |
| InChIKey | ABYAOQVGQXBXAA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|