C11H13NO2S — CID 114471358
4-(3-methylbut-3-enylsulfanyl)pyridine-2-carboxylic acid (PubChem CID 114471358) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 4-(3-methylbut-3-enylsulfanyl)pyridine-2-carboxylic acid.
| Compound Name | 4-(3-methylbut-3-enylsulfanyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 114471358 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 4-(3-methylbut-3-enylsulfanyl)pyridine-2-carboxylic acid |
| SMILES | C=C(C)CCSc1ccnc(C(=O)O)c1 |
| InChI | InChI=1S/C11H13NO2S/c1-8(2)4-6-15-9-3-5-12-10(7-9)11(13)14/h3,5,7H,1,4,6H2,2H3,(H,13,14) |
| InChIKey | RVZBAAGXMHHNBO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|