C25H34N4O6 — CID 10480565
2,6-diaminohexanoic acid;3-(3,4-dimethoxyphenyl)-3-(3-oxo-1H-isoindol-2-yl)propanamide (PubChem CID 10480565) has the molecular formula C25H34N4O6 and a molecular weight of 486.57 g/mol. Its IUPAC name is 2,6-diaminohexanoic acid;3-(3,4-dimethoxyphenyl)-3-(3-oxo-1H-isoindol-2-yl)propanamide.
| Compound Name | 2,6-diaminohexanoic acid;3-(3,4-dimethoxyphenyl)-3-(3-oxo-1H-isoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 10480565 |
| Molecular Formula | C25H34N4O6 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 2,6-diaminohexanoic acid;3-(3,4-dimethoxyphenyl)-3-(3-oxo-1H-isoindol-2-yl)propanamide |
| SMILES | COc1ccc(C(CC(N)=O)N2Cc3ccccc3C2=O)cc1OC.NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C19H20N2O4.C6H14N2O2/c1-24-16-8-7-12(9-17(16)25-2)15(10-18(20)22)21-11-13-5-3-4-6-14(13)19(21)23;7-4-2-1-3-5(8)6(9)10/h3-9,15H,10-11H2,1-2H3,(H2,20,22);5H,1-4,7-8H2,(H,9,10) |
| InChIKey | HIVVULIMSDQJNG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 171.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|