C15H20BrNS — CID 104806304
1-(3-bromophenyl)sulfanyl-N-ethylhept-5-yn-2-amine (PubChem CID 104806304) has the molecular formula C15H20BrNS and a molecular weight of 326.30 g/mol. Its IUPAC name is 1-(3-bromophenyl)sulfanyl-N-ethylhept-5-yn-2-amine.
| Compound Name | 1-(3-bromophenyl)sulfanyl-N-ethylhept-5-yn-2-amine |
|---|---|
| PubChem CID | 104806304 |
| Molecular Formula | C15H20BrNS |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 1-(3-bromophenyl)sulfanyl-N-ethylhept-5-yn-2-amine |
| SMILES | CC#CCCC(CSc1cccc(Br)c1)NCC |
| InChI | InChI=1S/C15H20BrNS/c1-3-5-6-9-14(17-4-2)12-18-15-10-7-8-13(16)11-15/h7-8,10-11,14,17H,4,6,9,12H2,1-2H3 |
| InChIKey | IBMSSQWJCYWMGU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|