C18H34N2 — CID 104806557
N,N,4-trimethyl-1-[1-(propylamino)hex-4-ynyl]cyclohexan-1-amine (PubChem CID 104806557) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is N,N,4-trimethyl-1-[1-(propylamino)hex-4-ynyl]cyclohexan-1-amine.
| Compound Name | N,N,4-trimethyl-1-[1-(propylamino)hex-4-ynyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 104806557 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | N,N,4-trimethyl-1-[1-(propylamino)hex-4-ynyl]cyclohexan-1-amine |
| SMILES | CC#CCCC(NCCC)C1(N(C)C)CCC(C)CC1 |
| InChI | InChI=1S/C18H34N2/c1-6-8-9-10-17(19-15-7-2)18(20(4)5)13-11-16(3)12-14-18/h16-17,19H,7,9-15H2,1-5H3 |
| InChIKey | QLSQNJIOCDWUKU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|