C18H33NO — CID 116769667
1-(1-methoxy-4,4-dimethylcyclohexyl)-N-propylhex-4-yn-1-amine (PubChem CID 116769667) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is 1-(1-methoxy-4,4-dimethylcyclohexyl)-N-propylhex-4-yn-1-amine.
| Compound Name | 1-(1-methoxy-4,4-dimethylcyclohexyl)-N-propylhex-4-yn-1-amine |
|---|---|
| PubChem CID | 116769667 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | 1-(1-methoxy-4,4-dimethylcyclohexyl)-N-propylhex-4-yn-1-amine |
| SMILES | CC#CCCC(NCCC)C1(OC)CCC(C)(C)CC1 |
| InChI | InChI=1S/C18H33NO/c1-6-8-9-10-16(19-15-7-2)18(20-5)13-11-17(3,4)12-14-18/h16,19H,7,9-15H2,1-5H3 |
| InChIKey | DZVOAPYPTSGGQC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|