C11H10F3NO2 — CID 104808341
1-pent-3-ynyl-4-(trifluoromethyl)pyrrole-3-carboxylic acid (PubChem CID 104808341) has the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. Its IUPAC name is 1-pent-3-ynyl-4-(trifluoromethyl)pyrrole-3-carboxylic acid.
| Compound Name | 1-pent-3-ynyl-4-(trifluoromethyl)pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 104808341 |
| Molecular Formula | C11H10F3NO2 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 1-pent-3-ynyl-4-(trifluoromethyl)pyrrole-3-carboxylic acid |
| SMILES | CC#CCCn1cc(C(=O)O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10F3NO2/c1-2-3-4-5-15-6-8(10(16)17)9(7-15)11(12,13)14/h6-7H,4-5H2,1H3,(H,16,17) |
| InChIKey | FOLONYAHGMBSSL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|