C13H8ClF4NO2 — CID 107882518
1-[(4-chloro-3-fluorophenyl)methyl]-4-(trifluoromethyl)pyrrole-3-carboxylic acid (PubChem CID 107882518) has the molecular formula C13H8ClF4NO2 and a molecular weight of 321.66 g/mol. Its IUPAC name is 1-[(4-chloro-3-fluorophenyl)methyl]-4-(trifluoromethyl)pyrrole-3-carboxylic acid.
| Compound Name | 1-[(4-chloro-3-fluorophenyl)methyl]-4-(trifluoromethyl)pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 107882518 |
| Molecular Formula | C13H8ClF4NO2 |
| Molecular Weight | 321.66 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 1-[(4-chloro-3-fluorophenyl)methyl]-4-(trifluoromethyl)pyrrole-3-carboxylic acid |
| SMILES | O=C(O)c1cn(Cc2ccc(Cl)c(F)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C13H8ClF4NO2/c14-10-2-1-7(3-11(10)15)4-19-5-8(12(20)21)9(6-19)13(16,17)18/h1-3,5-6H,4H2,(H,20,21) |
| InChIKey | YTUFQGACIHJCMF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.66 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |