About (5-bromo-3-pyridinyl)methyl 3-amino-4-fluorobenzoate
(5-bromo-3-pyridinyl)methyl 3-amino-4-fluorobenzoate (PubChem CID 104808390) has the molecular formula C13H10BrFN2O2
and a molecular weight of 325.14 g/mol. Its IUPAC name is (5-bromo-3-pyridinyl)methyl 3-amino-4-fluorobenzoate.
Molecular Properties
| Compound Name | (5-bromo-3-pyridinyl)methyl 3-amino-4-fluorobenzoate |
| PubChem CID | 104808390 |
| Molecular Formula | C13H10BrFN2O2 |
| Molecular Weight | 325.14 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | (5-bromo-3-pyridinyl)methyl 3-amino-4-fluorobenzoate |
| SMILES | Nc1cc(C(=O)OCc2cncc(Br)c2)ccc1F |
| InChI | InChI=1S/C13H10BrFN2O2/c14-10-3-8(5-17-6-10)7-19-13(18)9-1-2-11(15)12(16)4-9/h1-6H,7,16H2 |
| InChIKey | RHHVIYPLHGELJU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.14 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (5-bromo-3-pyridinyl)methyl 3-amino-4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-3-pyridinyl)methyl 3-amino-4-fluorobenzoate?
The IUPAC name of (5-bromo-3-pyridinyl)methyl 3-amino-4-fluorobenzoate (CID 104808390) is (5-bromo-3-pyridinyl)methyl 3-amino-4-fluorobenzoate.
What is the SMILES notation for (5-bromo-3-pyridinyl)methyl 3-amino-4-fluorobenzoate?
The canonical SMILES for (5-bromo-3-pyridinyl)methyl 3-amino-4-fluorobenzoate is Nc1cc(C(=O)OCc2cncc(Br)c2)ccc1F.
What is the InChIKey of (5-bromo-3-pyridinyl)methyl 3-amino-4-fluorobenzoate?
The InChIKey is RHHVIYPLHGELJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10BrFN2O2/c14-10-3-8(5-17-6-10)7-19-13(18)9-1-2-11(15)12(16)4-9/h1-6H,7,16H2.
What are the key properties of (5-bromo-3-pyridinyl)methyl 3-amino-4-fluorobenzoate?
(5-bromo-3-pyridinyl)methyl 3-amino-4-fluorobenzoate has a molecular weight of 325.14 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-3-pyridinyl)methyl 3-amino-4-fluorobenzoate is sourced from PubChem (CID 104808390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).