C12H15BrN6S — CID 104811481
N-[2-[5-[(5-bromo-2-pyridinyl)methylsulfanyl]tetrazol-1-yl]ethyl]cyclopropanamine (PubChem CID 104811481) has the molecular formula C12H15BrN6S and a molecular weight of 355.27 g/mol. Its IUPAC name is N-[2-[5-[(5-bromo-2-pyridinyl)methylsulfanyl]tetrazol-1-yl]ethyl]cyclopropanamine.
| Compound Name | N-[2-[5-[(5-bromo-2-pyridinyl)methylsulfanyl]tetrazol-1-yl]ethyl]cyclopropanamine |
|---|---|
| PubChem CID | 104811481 |
| Molecular Formula | C12H15BrN6S |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | N-[2-[5-[(5-bromo-2-pyridinyl)methylsulfanyl]tetrazol-1-yl]ethyl]cyclopropanamine |
| SMILES | Brc1ccc(CSc2nnnn2CCNC2CC2)nc1 |
| InChI | InChI=1S/C12H15BrN6S/c13-9-1-2-11(15-7-9)8-20-12-16-17-18-19(12)6-5-14-10-3-4-10/h1-2,7,10,14H,3-6,8H2 |
| InChIKey | WZYMTLCLBNRAKO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |