C13H15ClFN5S — CID 114859690
N-[2-[5-[(4-chloro-2-fluorophenyl)methylsulfanyl]tetrazol-1-yl]ethyl]cyclopropanamine (PubChem CID 114859690) has the molecular formula C13H15ClFN5S and a molecular weight of 327.82 g/mol. Its IUPAC name is N-[2-[5-[(4-chloro-2-fluorophenyl)methylsulfanyl]tetrazol-1-yl]ethyl]cyclopropanamine.
| Compound Name | N-[2-[5-[(4-chloro-2-fluorophenyl)methylsulfanyl]tetrazol-1-yl]ethyl]cyclopropanamine |
|---|---|
| PubChem CID | 114859690 |
| Molecular Formula | C13H15ClFN5S |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N-[2-[5-[(4-chloro-2-fluorophenyl)methylsulfanyl]tetrazol-1-yl]ethyl]cyclopropanamine |
| SMILES | Fc1cc(Cl)ccc1CSc1nnnn1CCNC1CC1 |
| InChI | InChI=1S/C13H15ClFN5S/c14-10-2-1-9(12(15)7-10)8-21-13-17-18-19-20(13)6-5-16-11-3-4-11/h1-2,7,11,16H,3-6,8H2 |
| InChIKey | AUIDHIWJMIAZEA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |