C10H11ClFN5S — CID 114012355
2-[5-[(4-chloro-3-fluorophenyl)methylsulfanyl]tetrazol-1-yl]ethanamine (PubChem CID 114012355) has the molecular formula C10H11ClFN5S and a molecular weight of 287.75 g/mol. Its IUPAC name is 2-[5-[(4-chloro-3-fluorophenyl)methylsulfanyl]tetrazol-1-yl]ethanamine.
| Compound Name | 2-[5-[(4-chloro-3-fluorophenyl)methylsulfanyl]tetrazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 114012355 |
| Molecular Formula | C10H11ClFN5S |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 2-[5-[(4-chloro-3-fluorophenyl)methylsulfanyl]tetrazol-1-yl]ethanamine |
| SMILES | NCCn1nnnc1SCc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C10H11ClFN5S/c11-8-2-1-7(5-9(8)12)6-18-10-14-15-16-17(10)4-3-13/h1-2,5H,3-4,6,13H2 |
| InChIKey | WXGASCINSCIJST-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |