C12H16FN5S — CID 105375397
2-[5-[(5-fluoro-2-methylphenyl)methylsulfanyl]tetrazol-1-yl]-N-methylethanamine (PubChem CID 105375397) has the molecular formula C12H16FN5S and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-[5-[(5-fluoro-2-methylphenyl)methylsulfanyl]tetrazol-1-yl]-N-methylethanamine.
| Compound Name | 2-[5-[(5-fluoro-2-methylphenyl)methylsulfanyl]tetrazol-1-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 105375397 |
| Molecular Formula | C12H16FN5S |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-[5-[(5-fluoro-2-methylphenyl)methylsulfanyl]tetrazol-1-yl]-N-methylethanamine |
| SMILES | CNCCn1nnnc1SCc1cc(F)ccc1C |
| InChI | InChI=1S/C12H16FN5S/c1-9-3-4-11(13)7-10(9)8-19-12-15-16-17-18(12)6-5-14-2/h3-4,7,14H,5-6,8H2,1-2H3 |
| InChIKey | POXJNSVUVFNVHR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |