C8H15N5S — CID 77104131
2-(5-but-2-enylsulfanyltetrazol-1-yl)-N-methylethanamine (PubChem CID 77104131) has the molecular formula C8H15N5S and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-(5-but-2-enylsulfanyltetrazol-1-yl)-N-methylethanamine.
| Compound Name | 2-(5-but-2-enylsulfanyltetrazol-1-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 77104131 |
| Molecular Formula | C8H15N5S |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-(5-but-2-enylsulfanyltetrazol-1-yl)-N-methylethanamine |
| SMILES | CC=CCSc1nnnn1CCNC |
| InChI | InChI=1S/C8H15N5S/c1-3-4-7-14-8-10-11-12-13(8)6-5-9-2/h3-4,9H,5-7H2,1-2H3 |
| InChIKey | UQVHXBSIFYHHRH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|