C11H23N5S2 — CID 114268875
N-[2-[5-(2-propan-2-ylsulfanylethylsulfanyl)tetrazol-1-yl]ethyl]propan-2-amine (PubChem CID 114268875) has the molecular formula C11H23N5S2 and a molecular weight of 289.47 g/mol. Its IUPAC name is N-[2-[5-(2-propan-2-ylsulfanylethylsulfanyl)tetrazol-1-yl]ethyl]propan-2-amine.
| Compound Name | N-[2-[5-(2-propan-2-ylsulfanylethylsulfanyl)tetrazol-1-yl]ethyl]propan-2-amine |
|---|---|
| PubChem CID | 114268875 |
| Molecular Formula | C11H23N5S2 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-[2-[5-(2-propan-2-ylsulfanylethylsulfanyl)tetrazol-1-yl]ethyl]propan-2-amine |
| SMILES | CC(C)NCCn1nnnc1SCCSC(C)C |
| InChI | InChI=1S/C11H23N5S2/c1-9(2)12-5-6-16-11(13-14-15-16)18-8-7-17-10(3)4/h9-10,12H,5-8H2,1-4H3 |
| InChIKey | WYZNDSAFRVVNCT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|