C10H21N5O2S2 — CID 106731830
N-ethyl-2-[5-(2-propan-2-ylsulfonylethylsulfanyl)tetrazol-1-yl]ethanamine (PubChem CID 106731830) has the molecular formula C10H21N5O2S2 and a molecular weight of 307.45 g/mol. Its IUPAC name is N-ethyl-2-[5-(2-propan-2-ylsulfonylethylsulfanyl)tetrazol-1-yl]ethanamine.
| Compound Name | N-ethyl-2-[5-(2-propan-2-ylsulfonylethylsulfanyl)tetrazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 106731830 |
| Molecular Formula | C10H21N5O2S2 |
| Molecular Weight | 307.45 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-ethyl-2-[5-(2-propan-2-ylsulfonylethylsulfanyl)tetrazol-1-yl]ethanamine |
| SMILES | CCNCCn1nnnc1SCCS(=O)(=O)C(C)C |
| InChI | InChI=1S/C10H21N5O2S2/c1-4-11-5-6-15-10(12-13-14-15)18-7-8-19(16,17)9(2)3/h9,11H,4-8H2,1-3H3 |
| InChIKey | GAQVPLCXBVXTHH-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.45 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|