C9H19N5O2S2 — CID 106725617
2-[5-(2-tert-butylsulfonylethylsulfanyl)tetrazol-1-yl]ethanamine (PubChem CID 106725617) has the molecular formula C9H19N5O2S2 and a molecular weight of 293.42 g/mol. Its IUPAC name is 2-[5-(2-tert-butylsulfonylethylsulfanyl)tetrazol-1-yl]ethanamine.
| Compound Name | 2-[5-(2-tert-butylsulfonylethylsulfanyl)tetrazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 106725617 |
| Molecular Formula | C9H19N5O2S2 |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-[5-(2-tert-butylsulfonylethylsulfanyl)tetrazol-1-yl]ethanamine |
| SMILES | CC(C)(C)S(=O)(=O)CCSc1nnnn1CCN |
| InChI | InChI=1S/C9H19N5O2S2/c1-9(2,3)18(15,16)7-6-17-8-11-12-13-14(8)5-4-10/h4-7,10H2,1-3H3 |
| InChIKey | VIXQRKNZHQGXES-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |