C9H19N5OS — CID 106453358
2-[5-[2-(2-methylpropoxy)ethylsulfanyl]tetrazol-1-yl]ethanamine (PubChem CID 106453358) has the molecular formula C9H19N5OS and a molecular weight of 245.35 g/mol. Its IUPAC name is 2-[5-[2-(2-methylpropoxy)ethylsulfanyl]tetrazol-1-yl]ethanamine.
| Compound Name | 2-[5-[2-(2-methylpropoxy)ethylsulfanyl]tetrazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 106453358 |
| Molecular Formula | C9H19N5OS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 2-[5-[2-(2-methylpropoxy)ethylsulfanyl]tetrazol-1-yl]ethanamine |
| SMILES | CC(C)COCCSc1nnnn1CCN |
| InChI | InChI=1S/C9H19N5OS/c1-8(2)7-15-5-6-16-9-11-12-13-14(9)4-3-10/h8H,3-7,10H2,1-2H3 |
| InChIKey | BGFVEVRTWWAXBB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|