methyl 2-[5-(2-propoxyethylsulfanyl)tetrazol-1-yl]acetate

C9H16N4O3S — CID 106449589

IUPACmethyl 2-[5-(2-propoxyethylsulfanyl)tetrazol-1-yl]acetate
SMILESCCCOCCSc1nnnn1CC(=O)OC
InChIInChI=1S/C9H16N4O3S/c1-3-4-16-5-6-17-9-10-11-12-13(9)7-8(14)15-2/h3-7H2,1-2H3
InChIKeyXEMZUVGPFQBNDB-UHFFFAOYSA-N
MW260.32 g/mol
LogP0.36
Rot. Bonds8

About methyl 2-[5-(2-propoxyethylsulfanyl)tetrazol-1-yl]acetate

methyl 2-[5-(2-propoxyethylsulfanyl)tetrazol-1-yl]acetate (PubChem CID 106449589) has the molecular formula C9H16N4O3S and a molecular weight of 260.32 g/mol. Its IUPAC name is methyl 2-[5-(2-propoxyethylsulfanyl)tetrazol-1-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[5-(2-propoxyethylsulfanyl)tetrazol-1-yl]acetate
PubChem CID106449589
Molecular FormulaC9H16N4O3S
Molecular Weight260.32 g/mol
Exact Mass260.09
IUPAC Namemethyl 2-[5-(2-propoxyethylsulfanyl)tetrazol-1-yl]acetate
SMILESCCCOCCSc1nnnn1CC(=O)OC
InChIInChI=1S/C9H16N4O3S/c1-3-4-16-5-6-17-9-10-11-12-13(9)7-8(14)15-2/h3-7H2,1-2H3
InChIKeyXEMZUVGPFQBNDB-UHFFFAOYSA-N
XLogP0.36
TPSA79.13 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds8
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.32
LogP ≤ 50.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 2-[5-(2-propoxyethylsulfanyl)tetrazol-1-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[5-(2-propoxyethylsulfanyl)tetrazol-1-yl]acetate?
The IUPAC name of methyl 2-[5-(2-propoxyethylsulfanyl)tetrazol-1-yl]acetate (CID 106449589) is methyl 2-[5-(2-propoxyethylsulfanyl)tetrazol-1-yl]acetate.
What is the SMILES notation for methyl 2-[5-(2-propoxyethylsulfanyl)tetrazol-1-yl]acetate?
The canonical SMILES for methyl 2-[5-(2-propoxyethylsulfanyl)tetrazol-1-yl]acetate is CCCOCCSc1nnnn1CC(=O)OC.
What is the InChIKey of methyl 2-[5-(2-propoxyethylsulfanyl)tetrazol-1-yl]acetate?
The InChIKey is XEMZUVGPFQBNDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O3S/c1-3-4-16-5-6-17-9-10-11-12-13(9)7-8(14)15-2/h3-7H2,1-2H3.
What are the key properties of methyl 2-[5-(2-propoxyethylsulfanyl)tetrazol-1-yl]acetate?
methyl 2-[5-(2-propoxyethylsulfanyl)tetrazol-1-yl]acetate has a molecular weight of 260.32 g/mol, XLogP of 0.36, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[5-(2-propoxyethylsulfanyl)tetrazol-1-yl]acetate is sourced from PubChem (CID 106449589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).