C11H22N4O4S — CID 103184249
1-(2,2-dimethoxyethyl)-5-[2-(3-methoxypropoxy)ethylsulfanyl]tetrazole (PubChem CID 103184249) has the molecular formula C11H22N4O4S and a molecular weight of 306.39 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-5-[2-(3-methoxypropoxy)ethylsulfanyl]tetrazole.
| Compound Name | 1-(2,2-dimethoxyethyl)-5-[2-(3-methoxypropoxy)ethylsulfanyl]tetrazole |
|---|---|
| PubChem CID | 103184249 |
| Molecular Formula | C11H22N4O4S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-5-[2-(3-methoxypropoxy)ethylsulfanyl]tetrazole |
| SMILES | COCCCOCCSc1nnnn1CC(OC)OC |
| InChI | InChI=1S/C11H22N4O4S/c1-16-5-4-6-19-7-8-20-11-12-13-14-15(11)9-10(17-2)18-3/h10H,4-9H2,1-3H3 |
| InChIKey | ZCDCTYWINVKCPI-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|