C12H20N6O2S — CID 66153085
1-(2,2-dimethoxyethyl)-5-[(3-propan-2-ylimidazol-4-yl)methylsulfanyl]tetrazole (PubChem CID 66153085) has the molecular formula C12H20N6O2S and a molecular weight of 312.40 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-5-[(3-propan-2-ylimidazol-4-yl)methylsulfanyl]tetrazole.
| Compound Name | 1-(2,2-dimethoxyethyl)-5-[(3-propan-2-ylimidazol-4-yl)methylsulfanyl]tetrazole |
|---|---|
| PubChem CID | 66153085 |
| Molecular Formula | C12H20N6O2S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-5-[(3-propan-2-ylimidazol-4-yl)methylsulfanyl]tetrazole |
| SMILES | COC(Cn1nnnc1SCc1cncn1C(C)C)OC |
| InChI | InChI=1S/C12H20N6O2S/c1-9(2)17-8-13-5-10(17)7-21-12-14-15-16-18(12)6-11(19-3)20-4/h5,8-9,11H,6-7H2,1-4H3 |
| InChIKey | XAAGPVFWOCNHRX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 79.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|