C10H18N4O2S — CID 66037128
1-(2,2-dimethoxyethyl)-5-(2-methylidenebutylsulfanyl)tetrazole (PubChem CID 66037128) has the molecular formula C10H18N4O2S and a molecular weight of 258.35 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-5-(2-methylidenebutylsulfanyl)tetrazole.
| Compound Name | 1-(2,2-dimethoxyethyl)-5-(2-methylidenebutylsulfanyl)tetrazole |
|---|---|
| PubChem CID | 66037128 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-5-(2-methylidenebutylsulfanyl)tetrazole |
| SMILES | C=C(CC)CSc1nnnn1CC(OC)OC |
| InChI | InChI=1S/C10H18N4O2S/c1-5-8(2)7-17-10-11-12-13-14(10)6-9(15-3)16-4/h9H,2,5-7H2,1,3-4H3 |
| InChIKey | OKPYYRSIEMRADN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|