C13H23N5O2S — CID 106714598
6-[1-(2,2-dimethoxyethyl)tetrazol-5-yl]sulfanyl-2,2-dimethylhexanenitrile (PubChem CID 106714598) has the molecular formula C13H23N5O2S and a molecular weight of 313.43 g/mol. Its IUPAC name is 6-[1-(2,2-dimethoxyethyl)tetrazol-5-yl]sulfanyl-2,2-dimethylhexanenitrile.
| Compound Name | 6-[1-(2,2-dimethoxyethyl)tetrazol-5-yl]sulfanyl-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106714598 |
| Molecular Formula | C13H23N5O2S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 6-[1-(2,2-dimethoxyethyl)tetrazol-5-yl]sulfanyl-2,2-dimethylhexanenitrile |
| SMILES | COC(Cn1nnnc1SCCCCC(C)(C)C#N)OC |
| InChI | InChI=1S/C13H23N5O2S/c1-13(2,10-14)7-5-6-8-21-12-15-16-17-18(12)9-11(19-3)20-4/h11H,5-9H2,1-4H3 |
| InChIKey | YGUKLXMTPMISKI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 85.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|