C9H15N7O2S — CID 107054515
1-(2,2-dimethoxyethyl)-5-[(1-methyltriazol-4-yl)methylsulfanyl]tetrazole (PubChem CID 107054515) has the molecular formula C9H15N7O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-5-[(1-methyltriazol-4-yl)methylsulfanyl]tetrazole.
| Compound Name | 1-(2,2-dimethoxyethyl)-5-[(1-methyltriazol-4-yl)methylsulfanyl]tetrazole |
|---|---|
| PubChem CID | 107054515 |
| Molecular Formula | C9H15N7O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-5-[(1-methyltriazol-4-yl)methylsulfanyl]tetrazole |
| SMILES | COC(Cn1nnnc1SCc1cn(C)nn1)OC |
| InChI | InChI=1S/C9H15N7O2S/c1-15-4-7(10-13-15)6-19-9-11-12-14-16(9)5-8(17-2)18-3/h4,8H,5-6H2,1-3H3 |
| InChIKey | XQYBILKKVFSAHZ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 92.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|