C12H24N6O2S — CID 82888087
1-[2-[1-(2,2-dimethoxyethyl)tetrazol-5-yl]sulfanylethyl]-4-methylpiperazine (PubChem CID 82888087) has the molecular formula C12H24N6O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 1-[2-[1-(2,2-dimethoxyethyl)tetrazol-5-yl]sulfanylethyl]-4-methylpiperazine.
| Compound Name | 1-[2-[1-(2,2-dimethoxyethyl)tetrazol-5-yl]sulfanylethyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 82888087 |
| Molecular Formula | C12H24N6O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 1-[2-[1-(2,2-dimethoxyethyl)tetrazol-5-yl]sulfanylethyl]-4-methylpiperazine |
| SMILES | COC(Cn1nnnc1SCCN1CCN(C)CC1)OC |
| InChI | InChI=1S/C12H24N6O2S/c1-16-4-6-17(7-5-16)8-9-21-12-13-14-15-18(12)10-11(19-2)20-3/h11H,4-10H2,1-3H3 |
| InChIKey | IQKMAGYESVREBD-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|