C15H17N5O2S — CID 36794835
2-[2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylethyl]isoindole-1,3-dione (PubChem CID 36794835) has the molecular formula C15H17N5O2S and a molecular weight of 331.40 g/mol. Its IUPAC name is 2-[2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 36794835 |
| Molecular Formula | C15H17N5O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-[2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylethyl]isoindole-1,3-dione |
| SMILES | CC(C)Cn1nnnc1SCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H17N5O2S/c1-10(2)9-20-15(16-17-18-20)23-8-7-19-13(21)11-5-3-4-6-12(11)14(19)22/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | MRHFIFUWZOEWNC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|