C14H15N5O2S — CID 27138926
2-[2-(1-propan-2-yltetrazol-5-yl)sulfanylethyl]isoindole-1,3-dione (PubChem CID 27138926) has the molecular formula C14H15N5O2S and a molecular weight of 317.37 g/mol. Its IUPAC name is 2-[2-(1-propan-2-yltetrazol-5-yl)sulfanylethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(1-propan-2-yltetrazol-5-yl)sulfanylethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 27138926 |
| Molecular Formula | C14H15N5O2S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 2-[2-(1-propan-2-yltetrazol-5-yl)sulfanylethyl]isoindole-1,3-dione |
| SMILES | CC(C)n1nnnc1SCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H15N5O2S/c1-9(2)19-14(15-16-17-19)22-8-7-18-12(20)10-5-3-4-6-11(10)13(18)21/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | YEHJBPMSPDLYHJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|