About methyl 2-[5-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]acetate
methyl 2-[5-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]acetate (PubChem CID 79399591) has the molecular formula C7H6BrN5O2S2
and a molecular weight of 336.20 g/mol. Its IUPAC name is methyl 2-[5-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[5-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]acetate |
| PubChem CID | 79399591 |
| Molecular Formula | C7H6BrN5O2S2 |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 334.91 |
| IUPAC Name | methyl 2-[5-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]acetate |
| SMILES | COC(=O)Cn1nnnc1Sc1nc(Br)cs1 |
| InChI | InChI=1S/C7H6BrN5O2S2/c1-15-5(14)2-13-6(10-11-12-13)17-7-9-4(8)3-16-7/h3H,2H2,1H3 |
| InChIKey | CGGATJCLHKBMFG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze methyl 2-[5-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[5-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]acetate?
The IUPAC name of methyl 2-[5-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]acetate (CID 79399591) is methyl 2-[5-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]acetate.
What is the SMILES notation for methyl 2-[5-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]acetate?
The canonical SMILES for methyl 2-[5-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]acetate is COC(=O)Cn1nnnc1Sc1nc(Br)cs1.
What is the InChIKey of methyl 2-[5-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]acetate?
The InChIKey is CGGATJCLHKBMFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrN5O2S2/c1-15-5(14)2-13-6(10-11-12-13)17-7-9-4(8)3-16-7/h3H,2H2,1H3.
What are the key properties of methyl 2-[5-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]acetate?
methyl 2-[5-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]acetate has a molecular weight of 336.20 g/mol, XLogP of 1.22, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[5-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]acetate is sourced from PubChem (CID 79399591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).