methyl 2-[5-[(3-bromo-4-pyridinyl)sulfanyl]tetrazol-1-yl]acetate

C9H8BrN5O2S — CID 104776625

IUPACmethyl 2-[5-[(3-bromo-4-pyridinyl)sulfanyl]tetrazol-1-yl]acetate
SMILESCOC(=O)Cn1nnnc1Sc1ccncc1Br
InChIInChI=1S/C9H8BrN5O2S/c1-17-8(16)5-15-9(12-13-14-15)18-7-2-3-11-4-6(7)10/h2-4H,5H2,1H3
InChIKeyYNRVMBIFVROIFI-UHFFFAOYSA-N
MW330.17 g/mol
LogP1.15
Rot. Bonds4

About methyl 2-[5-[(3-bromo-4-pyridinyl)sulfanyl]tetrazol-1-yl]acetate

methyl 2-[5-[(3-bromo-4-pyridinyl)sulfanyl]tetrazol-1-yl]acetate (PubChem CID 104776625) has the molecular formula C9H8BrN5O2S and a molecular weight of 330.17 g/mol. Its IUPAC name is methyl 2-[5-[(3-bromo-4-pyridinyl)sulfanyl]tetrazol-1-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[5-[(3-bromo-4-pyridinyl)sulfanyl]tetrazol-1-yl]acetate
PubChem CID104776625
Molecular FormulaC9H8BrN5O2S
Molecular Weight330.17 g/mol
Exact Mass328.96
IUPAC Namemethyl 2-[5-[(3-bromo-4-pyridinyl)sulfanyl]tetrazol-1-yl]acetate
SMILESCOC(=O)Cn1nnnc1Sc1ccncc1Br
InChIInChI=1S/C9H8BrN5O2S/c1-17-8(16)5-15-9(12-13-14-15)18-7-2-3-11-4-6(7)10/h2-4H,5H2,1H3
InChIKeyYNRVMBIFVROIFI-UHFFFAOYSA-N
XLogP1.15
TPSA82.79 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500330.17
LogP ≤ 51.15
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Analyze methyl 2-[5-[(3-bromo-4-pyridinyl)sulfanyl]tetrazol-1-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[5-[(3-bromo-4-pyridinyl)sulfanyl]tetrazol-1-yl]acetate?
The IUPAC name of methyl 2-[5-[(3-bromo-4-pyridinyl)sulfanyl]tetrazol-1-yl]acetate (CID 104776625) is methyl 2-[5-[(3-bromo-4-pyridinyl)sulfanyl]tetrazol-1-yl]acetate.
What is the SMILES notation for methyl 2-[5-[(3-bromo-4-pyridinyl)sulfanyl]tetrazol-1-yl]acetate?
The canonical SMILES for methyl 2-[5-[(3-bromo-4-pyridinyl)sulfanyl]tetrazol-1-yl]acetate is COC(=O)Cn1nnnc1Sc1ccncc1Br.
What is the InChIKey of methyl 2-[5-[(3-bromo-4-pyridinyl)sulfanyl]tetrazol-1-yl]acetate?
The InChIKey is YNRVMBIFVROIFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrN5O2S/c1-17-8(16)5-15-9(12-13-14-15)18-7-2-3-11-4-6(7)10/h2-4H,5H2,1H3.
What are the key properties of methyl 2-[5-[(3-bromo-4-pyridinyl)sulfanyl]tetrazol-1-yl]acetate?
methyl 2-[5-[(3-bromo-4-pyridinyl)sulfanyl]tetrazol-1-yl]acetate has a molecular weight of 330.17 g/mol, XLogP of 1.15, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[5-[(3-bromo-4-pyridinyl)sulfanyl]tetrazol-1-yl]acetate is sourced from PubChem (CID 104776625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).