C9H16N4O5S — CID 106988381
2-[5-[2-hydroxy-3-(2-methoxyethoxy)propyl]sulfanyltetrazol-1-yl]acetic acid (PubChem CID 106988381) has the molecular formula C9H16N4O5S and a molecular weight of 292.32 g/mol. Its IUPAC name is 2-[5-[2-hydroxy-3-(2-methoxyethoxy)propyl]sulfanyltetrazol-1-yl]acetic acid.
| Compound Name | 2-[5-[2-hydroxy-3-(2-methoxyethoxy)propyl]sulfanyltetrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 106988381 |
| Molecular Formula | C9H16N4O5S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 2-[5-[2-hydroxy-3-(2-methoxyethoxy)propyl]sulfanyltetrazol-1-yl]acetic acid |
| SMILES | COCCOCC(O)CSc1nnnn1CC(=O)O |
| InChI | InChI=1S/C9H16N4O5S/c1-17-2-3-18-5-7(14)6-19-9-10-11-12-13(9)4-8(15)16/h7,14H,2-6H2,1H3,(H,15,16) |
| InChIKey | KDOOWTNZNHKHJY-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|