About 3-[1-(carboxymethyl)tetrazol-5-yl]sulfanyl-2,2-dimethylpropanoic acid
3-[1-(carboxymethyl)tetrazol-5-yl]sulfanyl-2,2-dimethylpropanoic acid (PubChem CID 79630235) has the molecular formula C8H12N4O4S
and a molecular weight of 260.27 g/mol. Its IUPAC name is 3-[1-(carboxymethyl)tetrazol-5-yl]sulfanyl-2,2-dimethylpropanoic acid.
Molecular Properties
| Compound Name | 3-[1-(carboxymethyl)tetrazol-5-yl]sulfanyl-2,2-dimethylpropanoic acid |
| PubChem CID | 79630235 |
| Molecular Formula | C8H12N4O4S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 3-[1-(carboxymethyl)tetrazol-5-yl]sulfanyl-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CSc1nnnn1CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H12N4O4S/c1-8(2,6(15)16)4-17-7-9-10-11-12(7)3-5(13)14/h3-4H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | ZBPSORHUHLMSOZ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[1-(carboxymethyl)tetrazol-5-yl]sulfanyl-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(carboxymethyl)tetrazol-5-yl]sulfanyl-2,2-dimethylpropanoic acid?
The IUPAC name of 3-[1-(carboxymethyl)tetrazol-5-yl]sulfanyl-2,2-dimethylpropanoic acid (CID 79630235) is 3-[1-(carboxymethyl)tetrazol-5-yl]sulfanyl-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-[1-(carboxymethyl)tetrazol-5-yl]sulfanyl-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-[1-(carboxymethyl)tetrazol-5-yl]sulfanyl-2,2-dimethylpropanoic acid is CC(C)(CSc1nnnn1CC(=O)O)C(=O)O.
What is the InChIKey of 3-[1-(carboxymethyl)tetrazol-5-yl]sulfanyl-2,2-dimethylpropanoic acid?
The InChIKey is ZBPSORHUHLMSOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O4S/c1-8(2,6(15)16)4-17-7-9-10-11-12(7)3-5(13)14/h3-4H2,1-2H3,(H,13,14)(H,15,16).
What are the key properties of 3-[1-(carboxymethyl)tetrazol-5-yl]sulfanyl-2,2-dimethylpropanoic acid?
3-[1-(carboxymethyl)tetrazol-5-yl]sulfanyl-2,2-dimethylpropanoic acid has a molecular weight of 260.27 g/mol, XLogP of -0.04, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(carboxymethyl)tetrazol-5-yl]sulfanyl-2,2-dimethylpropanoic acid is sourced from PubChem (CID 79630235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).