C12H14AsN5O4S — CID 157270156
2-[5-[2-[4-[hydroxy(methyl)arsanyl]anilino]-2-oxoethyl]sulfanyltetrazol-1-yl]acetic acid (PubChem CID 157270156) has the molecular formula C12H14AsN5O4S and a molecular weight of 399.26 g/mol. Its IUPAC name is 2-[5-[2-[4-[hydroxy(methyl)arsanyl]anilino]-2-oxoethyl]sulfanyltetrazol-1-yl]acetic acid.
| Compound Name | 2-[5-[2-[4-[hydroxy(methyl)arsanyl]anilino]-2-oxoethyl]sulfanyltetrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 157270156 |
| Molecular Formula | C12H14AsN5O4S |
| Molecular Weight | 399.26 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | 2-[5-[2-[4-[hydroxy(methyl)arsanyl]anilino]-2-oxoethyl]sulfanyltetrazol-1-yl]acetic acid |
| SMILES | C[As](O)c1ccc(NC(=O)CSc2nnnn2CC(=O)O)cc1 |
| InChI | InChI=1S/C12H14AsN5O4S/c1-13(22)8-2-4-9(5-3-8)14-10(19)7-23-12-15-16-17-18(12)6-11(20)21/h2-5,22H,6-7H2,1H3,(H,14,19)(H,20,21) |
| InChIKey | ANBVKQDABBBRLW-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.26 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|