C12H25N5O3S — CID 106993060
1-(2-methoxyethoxy)-3-[1-[2-(propylamino)ethyl]tetrazol-5-yl]sulfanylpropan-2-ol (PubChem CID 106993060) has the molecular formula C12H25N5O3S and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-(2-methoxyethoxy)-3-[1-[2-(propylamino)ethyl]tetrazol-5-yl]sulfanylpropan-2-ol.
| Compound Name | 1-(2-methoxyethoxy)-3-[1-[2-(propylamino)ethyl]tetrazol-5-yl]sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 106993060 |
| Molecular Formula | C12H25N5O3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 1-(2-methoxyethoxy)-3-[1-[2-(propylamino)ethyl]tetrazol-5-yl]sulfanylpropan-2-ol |
| SMILES | CCCNCCn1nnnc1SCC(O)COCCOC |
| InChI | InChI=1S/C12H25N5O3S/c1-3-4-13-5-6-17-12(14-15-16-17)21-10-11(18)9-20-8-7-19-2/h11,13,18H,3-10H2,1-2H3 |
| InChIKey | KSOUFYNNOSYNQO-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|