C10H21N5O2S — CID 113382999
N-(2-methoxyethyl)-2-[5-(2-methoxypropylsulfanyl)tetrazol-1-yl]ethanamine (PubChem CID 113382999) has the molecular formula C10H21N5O2S and a molecular weight of 275.38 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[5-(2-methoxypropylsulfanyl)tetrazol-1-yl]ethanamine.
| Compound Name | N-(2-methoxyethyl)-2-[5-(2-methoxypropylsulfanyl)tetrazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 113382999 |
| Molecular Formula | C10H21N5O2S |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-(2-methoxyethyl)-2-[5-(2-methoxypropylsulfanyl)tetrazol-1-yl]ethanamine |
| SMILES | COCCNCCn1nnnc1SCC(C)OC |
| InChI | InChI=1S/C10H21N5O2S/c1-9(17-3)8-18-10-12-13-14-15(10)6-4-11-5-7-16-2/h9,11H,4-8H2,1-3H3 |
| InChIKey | LLJWHZPRWABVMM-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|