C7H13F2N5O — CID 115408738
N-[[1-(2,2-difluoroethyl)tetrazol-5-yl]methyl]-2-methoxyethanamine (PubChem CID 115408738) has the molecular formula C7H13F2N5O and a molecular weight of 221.21 g/mol. Its IUPAC name is N-[[1-(2,2-difluoroethyl)tetrazol-5-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[1-(2,2-difluoroethyl)tetrazol-5-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 115408738 |
| Molecular Formula | C7H13F2N5O |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | N-[[1-(2,2-difluoroethyl)tetrazol-5-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1nnnn1CC(F)F |
| InChI | InChI=1S/C7H13F2N5O/c1-15-3-2-10-4-7-11-12-13-14(7)5-6(8)9/h6,10H,2-5H2,1H3 |
| InChIKey | GZZHNTKNLUMPFI-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|