C11H23N5OS — CID 106458184
N-ethyl-2-[5-[2-(2-methylpropoxy)ethylsulfanyl]tetrazol-1-yl]ethanamine (PubChem CID 106458184) has the molecular formula C11H23N5OS and a molecular weight of 273.41 g/mol. Its IUPAC name is N-ethyl-2-[5-[2-(2-methylpropoxy)ethylsulfanyl]tetrazol-1-yl]ethanamine.
| Compound Name | N-ethyl-2-[5-[2-(2-methylpropoxy)ethylsulfanyl]tetrazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 106458184 |
| Molecular Formula | C11H23N5OS |
| Molecular Weight | 273.41 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | N-ethyl-2-[5-[2-(2-methylpropoxy)ethylsulfanyl]tetrazol-1-yl]ethanamine |
| SMILES | CCNCCn1nnnc1SCCOCC(C)C |
| InChI | InChI=1S/C11H23N5OS/c1-4-12-5-6-16-11(13-14-15-16)18-8-7-17-9-10(2)3/h10,12H,4-9H2,1-3H3 |
| InChIKey | HWNRGPGVHAKWMM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.41 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|