About 2-methyldec-8-yn-3-amine
2-methyldec-8-yn-3-amine (PubChem CID 104811927) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is 2-methyldec-8-yn-3-amine.
Molecular Properties
| Compound Name | 2-methyldec-8-yn-3-amine |
| PubChem CID | 104811927 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 2-methyldec-8-yn-3-amine |
| SMILES | CC#CCCCCC(N)C(C)C |
| InChI | InChI=1S/C11H21N/c1-4-5-6-7-8-9-11(12)10(2)3/h10-11H,6-9,12H2,1-3H3 |
| InChIKey | GBJWOZFIVFKCEY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyldec-8-yn-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyldec-8-yn-3-amine?
The IUPAC name of 2-methyldec-8-yn-3-amine (CID 104811927) is 2-methyldec-8-yn-3-amine.
What is the SMILES notation for 2-methyldec-8-yn-3-amine?
The canonical SMILES for 2-methyldec-8-yn-3-amine is CC#CCCCCC(N)C(C)C.
What is the InChIKey of 2-methyldec-8-yn-3-amine?
The InChIKey is GBJWOZFIVFKCEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N/c1-4-5-6-7-8-9-11(12)10(2)3/h10-11H,6-9,12H2,1-3H3.
What are the key properties of 2-methyldec-8-yn-3-amine?
2-methyldec-8-yn-3-amine has a molecular weight of 167.30 g/mol, XLogP of 2.55, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyldec-8-yn-3-amine is sourced from PubChem (CID 104811927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).