C16H26BrN3 — CID 104812451
1-[(5-bromo-2-pyridinyl)methyl]-2,2,5-triethylpiperazine (PubChem CID 104812451) has the molecular formula C16H26BrN3 and a molecular weight of 340.31 g/mol. Its IUPAC name is 1-[(5-bromo-2-pyridinyl)methyl]-2,2,5-triethylpiperazine.
| Compound Name | 1-[(5-bromo-2-pyridinyl)methyl]-2,2,5-triethylpiperazine |
|---|---|
| PubChem CID | 104812451 |
| Molecular Formula | C16H26BrN3 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1-[(5-bromo-2-pyridinyl)methyl]-2,2,5-triethylpiperazine |
| SMILES | CCC1CN(Cc2ccc(Br)cn2)C(CC)(CC)CN1 |
| InChI | InChI=1S/C16H26BrN3/c1-4-14-10-20(16(5-2,6-3)12-19-14)11-15-8-7-13(17)9-18-15/h7-9,14,19H,4-6,10-12H2,1-3H3 |
| InChIKey | FBLBNXWTONXBPC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |