About 1-[(5-bromo-3-pyridinyl)methyl]-5-cyclopropyl-2,2-dimethylpiperazine
1-[(5-bromo-3-pyridinyl)methyl]-5-cyclopropyl-2,2-dimethylpiperazine (PubChem CID 104812598) has the molecular formula C15H22BrN3
and a molecular weight of 324.27 g/mol. Its IUPAC name is 1-[(5-bromo-3-pyridinyl)methyl]-5-cyclopropyl-2,2-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-[(5-bromo-3-pyridinyl)methyl]-5-cyclopropyl-2,2-dimethylpiperazine |
| PubChem CID | 104812598 |
| Molecular Formula | C15H22BrN3 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 1-[(5-bromo-3-pyridinyl)methyl]-5-cyclopropyl-2,2-dimethylpiperazine |
| SMILES | CC1(C)CNC(C2CC2)CN1Cc1cncc(Br)c1 |
| InChI | InChI=1S/C15H22BrN3/c1-15(2)10-18-14(12-3-4-12)9-19(15)8-11-5-13(16)7-17-6-11/h5-7,12,14,18H,3-4,8-10H2,1-2H3 |
| InChIKey | ZLMCRZPJPVFXBQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(5-bromo-3-pyridinyl)methyl]-5-cyclopropyl-2,2-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-bromo-3-pyridinyl)methyl]-5-cyclopropyl-2,2-dimethylpiperazine?
The IUPAC name of 1-[(5-bromo-3-pyridinyl)methyl]-5-cyclopropyl-2,2-dimethylpiperazine (CID 104812598) is 1-[(5-bromo-3-pyridinyl)methyl]-5-cyclopropyl-2,2-dimethylpiperazine.
What is the SMILES notation for 1-[(5-bromo-3-pyridinyl)methyl]-5-cyclopropyl-2,2-dimethylpiperazine?
The canonical SMILES for 1-[(5-bromo-3-pyridinyl)methyl]-5-cyclopropyl-2,2-dimethylpiperazine is CC1(C)CNC(C2CC2)CN1Cc1cncc(Br)c1.
What is the InChIKey of 1-[(5-bromo-3-pyridinyl)methyl]-5-cyclopropyl-2,2-dimethylpiperazine?
The InChIKey is ZLMCRZPJPVFXBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22BrN3/c1-15(2)10-18-14(12-3-4-12)9-19(15)8-11-5-13(16)7-17-6-11/h5-7,12,14,18H,3-4,8-10H2,1-2H3.
What are the key properties of 1-[(5-bromo-3-pyridinyl)methyl]-5-cyclopropyl-2,2-dimethylpiperazine?
1-[(5-bromo-3-pyridinyl)methyl]-5-cyclopropyl-2,2-dimethylpiperazine has a molecular weight of 324.27 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-bromo-3-pyridinyl)methyl]-5-cyclopropyl-2,2-dimethylpiperazine is sourced from PubChem (CID 104812598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).