C14H22N2S — CID 64862066
5-cyclopropyl-2,2-dimethyl-1-(thiophen-3-ylmethyl)piperazine (PubChem CID 64862066) has the molecular formula C14H22N2S and a molecular weight of 250.41 g/mol. Its IUPAC name is 5-cyclopropyl-2,2-dimethyl-1-(thiophen-3-ylmethyl)piperazine.
| Compound Name | 5-cyclopropyl-2,2-dimethyl-1-(thiophen-3-ylmethyl)piperazine |
|---|---|
| PubChem CID | 64862066 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 5-cyclopropyl-2,2-dimethyl-1-(thiophen-3-ylmethyl)piperazine |
| SMILES | CC1(C)CNC(C2CC2)CN1Cc1ccsc1 |
| InChI | InChI=1S/C14H22N2S/c1-14(2)10-15-13(12-3-4-12)8-16(14)7-11-5-6-17-9-11/h5-6,9,12-13,15H,3-4,7-8,10H2,1-2H3 |
| InChIKey | CTHXIAORKRYRDN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |