C14H24N2S — CID 64841192
5-ethyl-2,2-dimethyl-1-(2-thiophen-3-ylethyl)piperazine (PubChem CID 64841192) has the molecular formula C14H24N2S and a molecular weight of 252.43 g/mol. Its IUPAC name is 5-ethyl-2,2-dimethyl-1-(2-thiophen-3-ylethyl)piperazine.
| Compound Name | 5-ethyl-2,2-dimethyl-1-(2-thiophen-3-ylethyl)piperazine |
|---|---|
| PubChem CID | 64841192 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 5-ethyl-2,2-dimethyl-1-(2-thiophen-3-ylethyl)piperazine |
| SMILES | CCC1CN(CCc2ccsc2)C(C)(C)CN1 |
| InChI | InChI=1S/C14H24N2S/c1-4-13-9-16(14(2,3)11-15-13)7-5-12-6-8-17-10-12/h6,8,10,13,15H,4-5,7,9,11H2,1-3H3 |
| InChIKey | KHGIJKKQULOFTB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |