C17H30N2S — CID 64847295
5-butan-2-yl-2-ethyl-2-methyl-1-(2-thiophen-3-ylethyl)piperazine (PubChem CID 64847295) has the molecular formula C17H30N2S and a molecular weight of 294.51 g/mol. Its IUPAC name is 5-butan-2-yl-2-ethyl-2-methyl-1-(2-thiophen-3-ylethyl)piperazine.
| Compound Name | 5-butan-2-yl-2-ethyl-2-methyl-1-(2-thiophen-3-ylethyl)piperazine |
|---|---|
| PubChem CID | 64847295 |
| Molecular Formula | C17H30N2S |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 5-butan-2-yl-2-ethyl-2-methyl-1-(2-thiophen-3-ylethyl)piperazine |
| SMILES | CCC(C)C1CN(CCc2ccsc2)C(C)(CC)CN1 |
| InChI | InChI=1S/C17H30N2S/c1-5-14(3)16-11-19(17(4,6-2)13-18-16)9-7-15-8-10-20-12-15/h8,10,12,14,16,18H,5-7,9,11,13H2,1-4H3 |
| InChIKey | VFMALPFMGAMZQA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |