C17H28N2S — CID 64842067
5-tert-butyl-2-cyclopropyl-2-methyl-1-(thiophen-3-ylmethyl)piperazine (PubChem CID 64842067) has the molecular formula C17H28N2S and a molecular weight of 292.49 g/mol. Its IUPAC name is 5-tert-butyl-2-cyclopropyl-2-methyl-1-(thiophen-3-ylmethyl)piperazine.
| Compound Name | 5-tert-butyl-2-cyclopropyl-2-methyl-1-(thiophen-3-ylmethyl)piperazine |
|---|---|
| PubChem CID | 64842067 |
| Molecular Formula | C17H28N2S |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 5-tert-butyl-2-cyclopropyl-2-methyl-1-(thiophen-3-ylmethyl)piperazine |
| SMILES | CC(C)(C)C1CN(Cc2ccsc2)C(C)(C2CC2)CN1 |
| InChI | InChI=1S/C17H28N2S/c1-16(2,3)15-10-19(9-13-7-8-20-11-13)17(4,12-18-15)14-5-6-14/h7-8,11,14-15,18H,5-6,9-10,12H2,1-4H3 |
| InChIKey | CRHFMQDPPWUCPX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |