C18H29N3 — CID 64842250
5-tert-butyl-2-cyclopropyl-2-methyl-1-(pyridin-2-ylmethyl)piperazine (PubChem CID 64842250) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is 5-tert-butyl-2-cyclopropyl-2-methyl-1-(pyridin-2-ylmethyl)piperazine.
| Compound Name | 5-tert-butyl-2-cyclopropyl-2-methyl-1-(pyridin-2-ylmethyl)piperazine |
|---|---|
| PubChem CID | 64842250 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 5-tert-butyl-2-cyclopropyl-2-methyl-1-(pyridin-2-ylmethyl)piperazine |
| SMILES | CC(C)(C)C1CN(Cc2ccccn2)C(C)(C2CC2)CN1 |
| InChI | InChI=1S/C18H29N3/c1-17(2,3)16-12-21(11-15-7-5-6-10-19-15)18(4,13-20-16)14-8-9-14/h5-7,10,14,16,20H,8-9,11-13H2,1-4H3 |
| InChIKey | XVEZTTQPHRONRA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |